| Compound Information | SONAR Target prediction | | Name: | L-765,314 | | Unique Identifier: | LOPAC 01246 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27H34N6O5 | | Molecular Weight: | 488.326 g/mol | | X log p: | 14.211 (online calculus) | | Lipinksi Failures | 2 | | TPSA | 93.03 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 11 | | Rotatable Bond Count: | 10 | | Canonical Smiles: | COc1cc2nc(nc(N)c2cc1OC)N1CCN(C(C1)C(=O)NC(C)(C)C)C(=O)OCc1ccccc1 | | Class: | Adrenoceptor | | Action: | Antagonist | | Selectivity: | alpha-1B |
| Species: |
4932 |
| Condition: |
NOP16 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8677±0.00452548 |
| Normalized OD Score: sc h |
1.1428±0.0229855 |
| Z-Score: |
6.7347±1.85852 |
| p-Value: |
0.0000000297038 |
| Z-Factor: |
-0.322488 |
| Fitness Defect: |
17.332 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 15|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-04-22 YYYY-MM-DD | | Plate CH Control (+): | 0.044975±0.00416 | | Plate DMSO Control (-): | 0.713525±0.03320 | | Plate Z-Factor: | 0.7932 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6603904 |
benzyl (2S)-4-(4-amino-6,7-dimethoxy-quinazolin-2-yl)-2-(tert-butylcarbamoyl)piperazine-1-carboxylate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 11747 | Additional Members: 10 | Rows returned: 0 | |
|
